C19H18N2O2 — CID 71101759
4-[(7S,8R)-7-hydroxy-1-methyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-2-yl]naphthalene-1-carbonitrile (PubChem CID 71101759) has the molecular formula C19H18N2O2 and a molecular weight of 306.36 g/mol. Its IUPAC name is 4-[(7S,8R)-7-hydroxy-1-methyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(7S,8R)-7-hydroxy-1-methyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 71101759 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-[(7S,8R)-7-hydroxy-1-methyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-2-yl]naphthalene-1-carbonitrile |
| SMILES | CC1C(c2ccc(C#N)c3ccccc23)C(=O)N2CC[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C19H18N2O2/c1-11-17(19(23)21-9-8-16(22)18(11)21)15-7-6-12(10-20)13-4-2-3-5-14(13)15/h2-7,11,16-18,22H,8-9H2,1H3/t11?,16-,17?,18+/m0/s1 |
| InChIKey | MPPDNDFPUUPDCE-QWOFEWRJSA-N |
| XLogP | 2.41 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |