C14H29N — CID 71102045
4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine (PubChem CID 71102045) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine.
| Compound Name | 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine |
|---|---|
| PubChem CID | 71102045 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine |
| SMILES | CCCN1CCC([C@@H](C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H29N/c1-6-9-15-10-7-13(8-11-15)12(2)14(3,4)5/h12-13H,6-11H2,1-5H3/t12-/m1/s1 |
| InChIKey | PTLGFJFDNYLFBX-GFCCVEGCSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |