About 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine
4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine (PubChem CID 71102045) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine.
Molecular Properties
| Compound Name | 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine |
| PubChem CID | 71102045 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine |
| SMILES | CCCN1CCC([C@@H](C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H29N/c1-6-9-15-10-7-13(8-11-15)12(2)14(3,4)5/h12-13H,6-11H2,1-5H3/t12-/m1/s1 |
| InChIKey | PTLGFJFDNYLFBX-GFCCVEGCSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine?
The IUPAC name of 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine (CID 71102045) is 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine.
What is the SMILES notation for 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine?
The canonical SMILES for 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine is CCCN1CCC([C@@H](C)C(C)(C)C)CC1.
What is the InChIKey of 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine?
The InChIKey is PTLGFJFDNYLFBX-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H29N/c1-6-9-15-10-7-13(8-11-15)12(2)14(3,4)5/h12-13H,6-11H2,1-5H3/t12-/m1/s1.
What are the key properties of 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine?
4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine has a molecular weight of 211.39 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-3,3-dimethylbutan-2-yl]-1-propylpiperidine is sourced from PubChem (CID 71102045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).