C20H29N3P2 — CID 71102345
1-[3-[(1S)-1-phenylethyl]-5-[phenyl(phosphanyl)methyl]-1,3,5-triazinan-1-yl]ethylphosphane (PubChem CID 71102345) has the molecular formula C20H29N3P2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-[3-[(1S)-1-phenylethyl]-5-[phenyl(phosphanyl)methyl]-1,3,5-triazinan-1-yl]ethylphosphane.
| Compound Name | 1-[3-[(1S)-1-phenylethyl]-5-[phenyl(phosphanyl)methyl]-1,3,5-triazinan-1-yl]ethylphosphane |
|---|---|
| PubChem CID | 71102345 |
| Molecular Formula | C20H29N3P2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[3-[(1S)-1-phenylethyl]-5-[phenyl(phosphanyl)methyl]-1,3,5-triazinan-1-yl]ethylphosphane |
| SMILES | CC(P)N1CN(C(P)c2ccccc2)CN([C@@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C20H29N3P2/c1-16(18-9-5-3-6-10-18)21-13-22(17(2)24)15-23(14-21)20(25)19-11-7-4-8-12-19/h3-12,16-17,20H,13-15,24-25H2,1-2H3/t16-,17?,20?/m0/s1 |
| InChIKey | NDXURNIVYRGDTR-VXESANQCSA-N |
| XLogP | 4.33 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|