C31H36F3N7O4 — CID 71102819
tert-butyl (3S)-3-[[3-amino-6-[3-[[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenyl]pyrazine-2-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 71102819) has the molecular formula C31H36F3N7O4 and a molecular weight of 627.67 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[3-amino-6-[3-[[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenyl]pyrazine-2-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[3-amino-6-[3-[[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenyl]pyrazine-2-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71102819 |
| Molecular Formula | C31H36F3N7O4 |
| Molecular Weight | 627.67 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | tert-butyl (3S)-3-[[3-amino-6-[3-[[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenyl]pyrazine-2-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)NCc2cccc(-c3cnc(N)c(C(=O)N[C@H]4CCCN(C(=O)OC(C)(C)C)C4)n3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C31H36F3N7O4/c1-18-10-11-21(14-23(18)31(32,33)34)39-28(43)37-15-19-7-5-8-20(13-19)24-16-36-26(35)25(40-24)27(42)38-22-9-6-12-41(17-22)29(44)45-30(2,3)4/h5,7-8,10-11,13-14,16,22H,6,9,12,15,17H2,1-4H3,(H2,35,36)(H,38,42)(H2,37,39,43)/t22-/m0/s1 |
| InChIKey | BOQWLYGSWSPCNB-QFIPXVFZSA-N |
| XLogP | 5.50 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |