C26H40F2O — CID 71103025
5-(2-cyclohex-2-en-1-ylpropyl)-2-[(E,3S)-6-ethoxy-3-ethyl-5-fluorohept-4-enyl]-3-fluorocyclohexa-1,3-diene (PubChem CID 71103025) has the molecular formula C26H40F2O and a molecular weight of 406.60 g/mol. Its IUPAC name is 5-(2-cyclohex-2-en-1-ylpropyl)-2-[(E,3S)-6-ethoxy-3-ethyl-5-fluorohept-4-enyl]-3-fluorocyclohexa-1,3-diene.
| Compound Name | 5-(2-cyclohex-2-en-1-ylpropyl)-2-[(E,3S)-6-ethoxy-3-ethyl-5-fluorohept-4-enyl]-3-fluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 71103025 |
| Molecular Formula | C26H40F2O |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | 5-(2-cyclohex-2-en-1-ylpropyl)-2-[(E,3S)-6-ethoxy-3-ethyl-5-fluorohept-4-enyl]-3-fluorocyclohexa-1,3-diene |
| SMILES | CCOC(C)/C(F)=C\[C@@H](CC)CCC1=CCC(CC(C)C2C=CCCC2)C=C1F |
| InChI | InChI=1S/C26H40F2O/c1-5-21(17-25(27)20(4)29-6-2)12-14-24-15-13-22(18-26(24)28)16-19(3)23-10-8-7-9-11-23/h8,10,15,17-23H,5-7,9,11-14,16H2,1-4H3/b25-17+/t19?,20?,21-,22?,23?/m0/s1 |
| InChIKey | VRLGPZPEDLXVBH-BGTHEOCXSA-N |
| XLogP | 8.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|