C40H35FN2O4 — CID 71103543
(4S,5R)-5-[2-butoxy-4-(3-hydroxyphenyl)phenyl]-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]-1-(4-phenylphenyl)imidazolidin-2-one (PubChem CID 71103543) has the molecular formula C40H35FN2O4 and a molecular weight of 626.73 g/mol. Its IUPAC name is (4S,5R)-5-[2-butoxy-4-(3-hydroxyphenyl)phenyl]-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]-1-(4-phenylphenyl)imidazolidin-2-one.
| Compound Name | (4S,5R)-5-[2-butoxy-4-(3-hydroxyphenyl)phenyl]-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]-1-(4-phenylphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 71103543 |
| Molecular Formula | C40H35FN2O4 |
| Molecular Weight | 626.73 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | (4S,5R)-5-[2-butoxy-4-(3-hydroxyphenyl)phenyl]-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]-1-(4-phenylphenyl)imidazolidin-2-one |
| SMILES | CCCCOc1cc(-c2cccc(O)c2)ccc1[C@@H]1[C@H](/C=C/C(=O)c2ccc(F)cc2)NC(=O)N1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H35FN2O4/c1-2-3-24-47-38-26-31(30-10-7-11-34(44)25-30)16-21-35(38)39-36(22-23-37(45)29-12-17-32(41)18-13-29)42-40(46)43(39)33-19-14-28(15-20-33)27-8-5-4-6-9-27/h4-23,25-26,36,39,44H,2-3,24H2,1H3,(H,42,46)/b23-22+/t36-,39+/m0/s1 |
| InChIKey | NERCUFNLKZNOKG-MAXQMYOMSA-N |
| XLogP | 9.12 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.73 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|