C38H34FNO6PS+ — CID 71103544
[4-[4-[(4R,5R)-5-[3-(4-fluorophenyl)-3-oxopropyl]-2-oxo-3-(4-phenylphenyl)-1,3-thiazolidin-4-yl]-3-hydroxyphenyl]phenyl]-hydroxy-dimethoxyphosphanium (PubChem CID 71103544) has the molecular formula C38H34FNO6PS+ and a molecular weight of 682.73 g/mol. Its IUPAC name is [4-[4-[(4R,5R)-5-[3-(4-fluorophenyl)-3-oxopropyl]-2-oxo-3-(4-phenylphenyl)-1,3-thiazolidin-4-yl]-3-hydroxyphenyl]phenyl]-hydroxy-dimethoxyphosphanium.
| Compound Name | [4-[4-[(4R,5R)-5-[3-(4-fluorophenyl)-3-oxopropyl]-2-oxo-3-(4-phenylphenyl)-1,3-thiazolidin-4-yl]-3-hydroxyphenyl]phenyl]-hydroxy-dimethoxyphosphanium |
|---|---|
| PubChem CID | 71103544 |
| Molecular Formula | C38H34FNO6PS+ |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.18 |
| IUPAC Name | [4-[4-[(4R,5R)-5-[3-(4-fluorophenyl)-3-oxopropyl]-2-oxo-3-(4-phenylphenyl)-1,3-thiazolidin-4-yl]-3-hydroxyphenyl]phenyl]-hydroxy-dimethoxyphosphanium |
| SMILES | CO[P+](O)(OC)c1ccc(-c2ccc([C@@H]3[C@@H](CCC(=O)c4ccc(F)cc4)SC(=O)N3c3ccc(-c4ccccc4)cc3)c(O)c2)cc1 |
| InChI | InChI=1S/C38H33FNO6PS/c1-45-47(44,46-2)32-19-12-27(13-20-32)29-14-21-33(35(42)24-29)37-36(23-22-34(41)28-8-15-30(39)16-9-28)48-38(43)40(37)31-17-10-26(11-18-31)25-6-4-3-5-7-25/h3-21,24,36-37,44H,22-23H2,1-2H3/p+1/t36-,37-/m1/s1 |
| InChIKey | KAVWMNVAOISRPC-FZNHDDJXSA-O |
| XLogP | 8.98 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|