C37H35FN2O6P+ — CID 71103555
[4-[4-[(4R,5R)-5-[3-(4-fluorophenyl)-3-hydroxypropyl]-1-methyl-2-oxo-3-(4-phenylphenyl)imidazolidin-4-yl]-3-hydroxyphenyl]phenyl]-trihydroxyphosphanium (PubChem CID 71103555) has the molecular formula C37H35FN2O6P+ and a molecular weight of 653.67 g/mol. Its IUPAC name is [4-[4-[(4R,5R)-5-[3-(4-fluorophenyl)-3-hydroxypropyl]-1-methyl-2-oxo-3-(4-phenylphenyl)imidazolidin-4-yl]-3-hydroxyphenyl]phenyl]-trihydroxyphosphanium.
| Compound Name | [4-[4-[(4R,5R)-5-[3-(4-fluorophenyl)-3-hydroxypropyl]-1-methyl-2-oxo-3-(4-phenylphenyl)imidazolidin-4-yl]-3-hydroxyphenyl]phenyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 71103555 |
| Molecular Formula | C37H35FN2O6P+ |
| Molecular Weight | 653.67 g/mol |
| Exact Mass | 653.22 |
| IUPAC Name | [4-[4-[(4R,5R)-5-[3-(4-fluorophenyl)-3-hydroxypropyl]-1-methyl-2-oxo-3-(4-phenylphenyl)imidazolidin-4-yl]-3-hydroxyphenyl]phenyl]-trihydroxyphosphanium |
| SMILES | CN1C(=O)N(c2ccc(-c3ccccc3)cc2)[C@H](c2ccc(-c3ccc([P+](O)(O)O)cc3)cc2O)[C@H]1CCC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C37H34FN2O6P/c1-39-33(21-22-34(41)27-7-14-29(38)15-8-27)36(40(37(39)43)30-16-9-25(10-17-30)24-5-3-2-4-6-24)32-20-13-28(23-35(32)42)26-11-18-31(19-12-26)47(44,45)46/h2-20,23,33-34,36,41,44-46H,21-22H2,1H3/p+1/t33-,34?,36-/m1/s1 |
| InChIKey | KBALMEDSWLAKTE-LZCQFPOASA-O |
| XLogP | 6.73 |
| TPSA | 124.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.67 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|