C29H33NO4 — CID 71103580
(3S,4R)-4-(2,4-dibutoxyphenyl)-3-hydroxy-1-(4-phenylphenyl)azetidin-2-one (PubChem CID 71103580) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is (3S,4R)-4-(2,4-dibutoxyphenyl)-3-hydroxy-1-(4-phenylphenyl)azetidin-2-one.
| Compound Name | (3S,4R)-4-(2,4-dibutoxyphenyl)-3-hydroxy-1-(4-phenylphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 71103580 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (3S,4R)-4-(2,4-dibutoxyphenyl)-3-hydroxy-1-(4-phenylphenyl)azetidin-2-one |
| SMILES | CCCCOc1ccc([C@@H]2[C@H](O)C(=O)N2c2ccc(-c3ccccc3)cc2)c(OCCCC)c1 |
| InChI | InChI=1S/C29H33NO4/c1-3-5-18-33-24-16-17-25(26(20-24)34-19-6-4-2)27-28(31)29(32)30(27)23-14-12-22(13-15-23)21-10-8-7-9-11-21/h7-17,20,27-28,31H,3-6,18-19H2,1-2H3/t27-,28+/m1/s1 |
| InChIKey | ZMPUPDJJSKFNSN-IZLXSDGUSA-N |
| XLogP | 6.16 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|