C30H28FNO5S — CID 71103595
2-[(3R,4S)-4-[(3R)-3-(4-fluorophenyl)-3-hydroxypropyl]-1,1-dioxo-2-(4-phenylphenyl)thiazetidin-3-yl]-5-methoxyphenol (PubChem CID 71103595) has the molecular formula C30H28FNO5S and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-[(3R,4S)-4-[(3R)-3-(4-fluorophenyl)-3-hydroxypropyl]-1,1-dioxo-2-(4-phenylphenyl)thiazetidin-3-yl]-5-methoxyphenol.
| Compound Name | 2-[(3R,4S)-4-[(3R)-3-(4-fluorophenyl)-3-hydroxypropyl]-1,1-dioxo-2-(4-phenylphenyl)thiazetidin-3-yl]-5-methoxyphenol |
|---|---|
| PubChem CID | 71103595 |
| Molecular Formula | C30H28FNO5S |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 2-[(3R,4S)-4-[(3R)-3-(4-fluorophenyl)-3-hydroxypropyl]-1,1-dioxo-2-(4-phenylphenyl)thiazetidin-3-yl]-5-methoxyphenol |
| SMILES | COc1ccc([C@@H]2[C@H](CC[C@@H](O)c3ccc(F)cc3)S(=O)(=O)N2c2ccc(-c3ccccc3)cc2)c(O)c1 |
| InChI | InChI=1S/C30H28FNO5S/c1-37-25-15-16-26(28(34)19-25)30-29(18-17-27(33)22-7-11-23(31)12-8-22)38(35,36)32(30)24-13-9-21(10-14-24)20-5-3-2-4-6-20/h2-16,19,27,29-30,33-34H,17-18H2,1H3/t27-,29+,30-/m1/s1 |
| InChIKey | DOMMBPJHQKFQBE-CCNCKIRNSA-N |
| XLogP | 5.98 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|