C19H18N2O3 — CID 71103696
spiro[2,3,4,5-tetrahydro-[1,3]diazepino[1,2-a]indole-11,3'-2H-1-benzofuran]-5',6'-diol (PubChem CID 71103696) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is spiro[2,3,4,5-tetrahydro-[1,3]diazepino[1,2-a]indole-11,3'-2H-1-benzofuran]-5',6'-diol.
| Compound Name | spiro[2,3,4,5-tetrahydro-[1,3]diazepino[1,2-a]indole-11,3'-2H-1-benzofuran]-5',6'-diol |
|---|---|
| PubChem CID | 71103696 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | spiro[2,3,4,5-tetrahydro-[1,3]diazepino[1,2-a]indole-11,3'-2H-1-benzofuran]-5',6'-diol |
| SMILES | Oc1cc2c(cc1O)C1(CO2)C2=NCCCCN2c2ccccc21 |
| InChI | InChI=1S/C19H18N2O3/c22-15-9-13-17(10-16(15)23)24-11-19(13)12-5-1-2-6-14(12)21-8-4-3-7-20-18(19)21/h1-2,5-6,9-10,22-23H,3-4,7-8,11H2 |
| InChIKey | NCVMVYFINSWEBP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|