C31H28FNO4 — CID 71103913
(4S,5S)-5-(2,4-dihydroxyphenyl)-4-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-(4-phenylphenyl)pyrrolidin-2-one (PubChem CID 71103913) has the molecular formula C31H28FNO4 and a molecular weight of 497.57 g/mol. Its IUPAC name is (4S,5S)-5-(2,4-dihydroxyphenyl)-4-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-(4-phenylphenyl)pyrrolidin-2-one.
| Compound Name | (4S,5S)-5-(2,4-dihydroxyphenyl)-4-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-(4-phenylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 71103913 |
| Molecular Formula | C31H28FNO4 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | (4S,5S)-5-(2,4-dihydroxyphenyl)-4-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-(4-phenylphenyl)pyrrolidin-2-one |
| SMILES | O=C1C[C@H](CC[C@H](O)c2ccc(F)cc2)[C@@H](c2ccc(O)cc2O)N1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28FNO4/c32-24-11-6-22(7-12-24)28(35)17-10-23-18-30(37)33(31(23)27-16-15-26(34)19-29(27)36)25-13-8-21(9-14-25)20-4-2-1-3-5-20/h1-9,11-16,19,23,28,31,34-36H,10,17-18H2/t23-,28-,31-/m0/s1 |
| InChIKey | AYOJOUSWJOCMAJ-UEACAHGMSA-N |
| XLogP | 6.51 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|