C29H30FN3O7 — CID 71104118
9-[(1-fluoropropan-2-ylamino)methyl]-1,10,11-trihydroxy-7-(6-methoxy-3-pyridinyl)-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 71104118) has the molecular formula C29H30FN3O7 and a molecular weight of 551.57 g/mol. Its IUPAC name is 9-[(1-fluoropropan-2-ylamino)methyl]-1,10,11-trihydroxy-7-(6-methoxy-3-pyridinyl)-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-[(1-fluoropropan-2-ylamino)methyl]-1,10,11-trihydroxy-7-(6-methoxy-3-pyridinyl)-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 71104118 |
| Molecular Formula | C29H30FN3O7 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 9-[(1-fluoropropan-2-ylamino)methyl]-1,10,11-trihydroxy-7-(6-methoxy-3-pyridinyl)-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1ccc(-c2cc(CNC(C)CF)c(O)c3c2CC2CC4CC(=O)C(C(N)=O)=C(O)C4C(=O)C2=C3O)cn1 |
| InChI | InChI=1S/C29H30FN3O7/c1-12(9-30)32-11-16-7-17(13-3-4-20(40-2)33-10-13)18-6-14-5-15-8-19(34)24(29(31)39)28(38)22(15)26(36)21(14)27(37)23(18)25(16)35/h3-4,7,10,12,14-15,22,32,35,37-38H,5-6,8-9,11H2,1-2H3,(H2,31,39) |
| InChIKey | IIRCJYPBHIUVOE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 172.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|