C31H35FN4O7 — CID 71104241
(4S)-4-(dimethylamino)-9-[(1-fluoropropan-2-ylamino)methyl]-3,10,11-trihydroxy-7-(6-methoxy-3-pyridinyl)-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 71104241) has the molecular formula C31H35FN4O7 and a molecular weight of 594.64 g/mol. Its IUPAC name is (4S)-4-(dimethylamino)-9-[(1-fluoropropan-2-ylamino)methyl]-3,10,11-trihydroxy-7-(6-methoxy-3-pyridinyl)-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S)-4-(dimethylamino)-9-[(1-fluoropropan-2-ylamino)methyl]-3,10,11-trihydroxy-7-(6-methoxy-3-pyridinyl)-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 71104241 |
| Molecular Formula | C31H35FN4O7 |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | (4S)-4-(dimethylamino)-9-[(1-fluoropropan-2-ylamino)methyl]-3,10,11-trihydroxy-7-(6-methoxy-3-pyridinyl)-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1ccc(-c2cc(CNC(C)CF)c(O)c3c2CC2CC4C(C(=O)C(C(N)=O)=C(O)[C@H]4N(C)C)C(=O)C2=C3O)cn1 |
| InChI | InChI=1S/C31H35FN4O7/c1-13(10-32)34-12-16-9-17(14-5-6-20(43-4)35-11-14)18-7-15-8-19-23(28(39)21(15)27(38)22(18)26(16)37)29(40)24(31(33)42)30(41)25(19)36(2)3/h5-6,9,11,13,15,19,23,25,34,37-38,41H,7-8,10,12H2,1-4H3,(H2,33,42)/t13?,15?,19?,23?,25-/m0/s1 |
| InChIKey | QLUOIZUKXGZLOO-NBXVZSGKSA-N |
| XLogP | 2.37 |
| TPSA | 175.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|