About 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane
2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane (PubChem CID 71104329) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane |
| PubChem CID | 71104329 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane |
| SMILES | CCCC(C)Oc1c(C)cc(C2OCC2(C)C)cc1C |
| InChI | InChI=1S/C18H28O2/c1-7-8-14(4)20-16-12(2)9-15(10-13(16)3)17-18(5,6)11-19-17/h9-10,14,17H,7-8,11H2,1-6H3 |
| InChIKey | UDUYMRDVMLCOIC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane?
The IUPAC name of 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane (CID 71104329) is 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane.
What is the SMILES notation for 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane?
The canonical SMILES for 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane is CCCC(C)Oc1c(C)cc(C2OCC2(C)C)cc1C.
What is the InChIKey of 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane?
The InChIKey is UDUYMRDVMLCOIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-7-8-14(4)20-16-12(2)9-15(10-13(16)3)17-18(5,6)11-19-17/h9-10,14,17H,7-8,11H2,1-6H3.
What are the key properties of 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane?
2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane has a molecular weight of 276.42 g/mol, XLogP of 4.97, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-4-pentan-2-yloxyphenyl)-3,3-dimethyloxetane is sourced from PubChem (CID 71104329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).