C33H65NO9 — CID 71104362
tert-butyl N-[(2S,3R)-3-hydroxy-4-methyl-1-[(2S,5S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxypentan-2-yl]carbamate (PubChem CID 71104362) has the molecular formula C33H65NO9 and a molecular weight of 619.88 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-hydroxy-4-methyl-1-[(2S,5S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxypentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-methyl-1-[(2S,5S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 71104362 |
| Molecular Formula | C33H65NO9 |
| Molecular Weight | 619.88 g/mol |
| Exact Mass | 619.47 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-methyl-1-[(2S,5S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxypentan-2-yl]carbamate |
| SMILES | CCCCOCC1O[C@H](OC[C@H](NC(=O)OC(C)(C)C)[C@H](O)C(C)C)C(OCCCC)C(OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C33H65NO9/c1-10-14-18-37-23-26-28(38-19-15-11-2)29(39-20-16-12-3)30(40-21-17-13-4)31(42-26)41-22-25(27(35)24(5)6)34-32(36)43-33(7,8)9/h24-31,35H,10-23H2,1-9H3,(H,34,36)/t25-,26?,27+,28-,29?,30?,31-/m0/s1 |
| InChIKey | LCZHYDHDACVRQS-YIFPJEILSA-N |
| XLogP | 6.01 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.88 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|