C24H34N2O2 — CID 71104430
4-[(2R)-2-methoxypropyl]-N-[3-(2-propyl-2,3-dihydro-1,4-benzoxazin-4-yl)propyl]aniline (PubChem CID 71104430) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 4-[(2R)-2-methoxypropyl]-N-[3-(2-propyl-2,3-dihydro-1,4-benzoxazin-4-yl)propyl]aniline.
| Compound Name | 4-[(2R)-2-methoxypropyl]-N-[3-(2-propyl-2,3-dihydro-1,4-benzoxazin-4-yl)propyl]aniline |
|---|---|
| PubChem CID | 71104430 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 4-[(2R)-2-methoxypropyl]-N-[3-(2-propyl-2,3-dihydro-1,4-benzoxazin-4-yl)propyl]aniline |
| SMILES | CCCC1CN(CCCNc2ccc(C[C@@H](C)OC)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C24H34N2O2/c1-4-8-22-18-26(23-9-5-6-10-24(23)28-22)16-7-15-25-21-13-11-20(12-14-21)17-19(2)27-3/h5-6,9-14,19,22,25H,4,7-8,15-18H2,1-3H3/t19-,22?/m1/s1 |
| InChIKey | VFRBJUWJPNSIAV-LCQOSCCDSA-N |
| XLogP | 5.13 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|