C27H35F3N2O3 — CID 71104614
ethyl 2-[1-[1-methyl-3-oxo-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,3'-cyclopentane]-1'-yl]piperidin-3-yl]acetate (PubChem CID 71104614) has the molecular formula C27H35F3N2O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is ethyl 2-[1-[1-methyl-3-oxo-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,3'-cyclopentane]-1'-yl]piperidin-3-yl]acetate.
| Compound Name | ethyl 2-[1-[1-methyl-3-oxo-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,3'-cyclopentane]-1'-yl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 71104614 |
| Molecular Formula | C27H35F3N2O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | ethyl 2-[1-[1-methyl-3-oxo-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,3'-cyclopentane]-1'-yl]piperidin-3-yl]acetate |
| SMILES | CCOC(=O)CC1CCCN(C2CCC3(C2)C(=O)N2Cc4cc(C(F)(F)F)ccc4CC2C3C)C1 |
| InChI | InChI=1S/C27H35F3N2O3/c1-3-35-24(33)11-18-5-4-10-31(15-18)22-8-9-26(14-22)17(2)23-13-19-6-7-21(27(28,29)30)12-20(19)16-32(23)25(26)34/h6-7,12,17-18,22-23H,3-5,8-11,13-16H2,1-2H3 |
| InChIKey | OXYMTSUIRRSPLI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |