C22H25ClN4O3S — CID 71104801
N-[(1R,2S)-2-[(5-chloro-3a,7a-dihydro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazole-2-carboxamide (PubChem CID 71104801) has the molecular formula C22H25ClN4O3S and a molecular weight of 460.99 g/mol. Its IUPAC name is N-[(1R,2S)-2-[(5-chloro-3a,7a-dihydro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazole-2-carboxamide.
| Compound Name | N-[(1R,2S)-2-[(5-chloro-3a,7a-dihydro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 71104801 |
| Molecular Formula | C22H25ClN4O3S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-[(1R,2S)-2-[(5-chloro-3a,7a-dihydro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazole-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@H]1NC(=O)c1nc2c(s1)COCC2)C1=CC2C=C(Cl)C=CC2N1 |
| InChI | InChI=1S/C22H25ClN4O3S/c23-13-5-6-14-12(9-13)10-18(24-14)20(28)25-15-3-1-2-4-16(15)26-21(29)22-27-17-7-8-30-11-19(17)31-22/h5-6,9-10,12,14-16,24H,1-4,7-8,11H2,(H,25,28)(H,26,29)/t12?,14?,15-,16+/m0/s1 |
| InChIKey | JZFUJQZBFCHHJY-DISOXQEGSA-N |
| XLogP | 2.54 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |