C24H31N5O2S — CID 71104846
5-methyl-N-[(1R,2S)-2-[(5-methyl-6,7-dihydro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 71104846) has the molecular formula C24H31N5O2S and a molecular weight of 453.61 g/mol. Its IUPAC name is 5-methyl-N-[(1R,2S)-2-[(5-methyl-6,7-dihydro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | 5-methyl-N-[(1R,2S)-2-[(5-methyl-6,7-dihydro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71104846 |
| Molecular Formula | C24H31N5O2S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 5-methyl-N-[(1R,2S)-2-[(5-methyl-6,7-dihydro-1H-indole-2-carbonyl)amino]cyclohexyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CC1=Cc2cc(C(=O)NC3CCCC[C@H]3NC(=O)c3nc4c(s3)CN(C)CC4)[nH]c2CC1 |
| InChI | InChI=1S/C24H31N5O2S/c1-14-7-8-16-15(11-14)12-20(25-16)22(30)26-17-5-3-4-6-18(17)27-23(31)24-28-19-9-10-29(2)13-21(19)32-24/h11-12,17-18,25H,3-10,13H2,1-2H3,(H,26,30)(H,27,31)/t17?,18-/m1/s1 |
| InChIKey | DECMUFJRTJFATB-QRWMCTBCSA-N |
| XLogP | 3.28 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |