C59H38N6 — CID 71104991
2-[3,5-bis(4-naphthalen-1-yl-6-phenylpyrimidin-2-yl)phenyl]-1-phenylbenzimidazole (PubChem CID 71104991) has the molecular formula C59H38N6 and a molecular weight of 831.00 g/mol. Its IUPAC name is 2-[3,5-bis(4-naphthalen-1-yl-6-phenylpyrimidin-2-yl)phenyl]-1-phenylbenzimidazole.
| Compound Name | 2-[3,5-bis(4-naphthalen-1-yl-6-phenylpyrimidin-2-yl)phenyl]-1-phenylbenzimidazole |
|---|---|
| PubChem CID | 71104991 |
| Molecular Formula | C59H38N6 |
| Molecular Weight | 831.00 g/mol |
| Exact Mass | 830.32 |
| IUPAC Name | 2-[3,5-bis(4-naphthalen-1-yl-6-phenylpyrimidin-2-yl)phenyl]-1-phenylbenzimidazole |
| SMILES | c1ccc(-c2cc(-c3cccc4ccccc34)nc(-c3cc(-c4nc(-c5ccccc5)cc(-c5cccc6ccccc56)n4)cc(-c4nc5ccccc5n4-c4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C59H38N6/c1-4-20-41(21-5-1)52-37-54(49-30-16-24-39-18-10-12-28-47(39)49)62-57(60-52)43-34-44(36-45(35-43)59-64-51-32-14-15-33-56(51)65(59)46-26-8-3-9-27-46)58-61-53(42-22-6-2-7-23-42)38-55(63-58)50-31-17-25-40-19-11-13-29-48(40)50/h1-38H |
| InChIKey | UOHCEVWEQODTAG-UHFFFAOYSA-N |
| XLogP | 14.58 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.00 |
| LogP ≤ 5 | 14.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |