C20H26N2O5S — CID 71105264
[(3aR,5S,6S,7S,7aR)-2-(N-acetyl-4-methoxyanilino)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate (PubChem CID 71105264) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is [(3aR,5S,6S,7S,7aR)-2-(N-acetyl-4-methoxyanilino)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate.
| Compound Name | [(3aR,5S,6S,7S,7aR)-2-(N-acetyl-4-methoxyanilino)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 71105264 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [(3aR,5S,6S,7S,7aR)-2-(N-acetyl-4-methoxyanilino)-6,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
| SMILES | COc1ccc(N(C(C)=O)C2=N[C@@H]3[C@@H](C)[C@H](C)[C@@H](COC(C)=O)O[C@@H]3S2)cc1 |
| InChI | InChI=1S/C20H26N2O5S/c1-11-12(2)18-19(27-17(11)10-26-14(4)24)28-20(21-18)22(13(3)23)15-6-8-16(25-5)9-7-15/h6-9,11-12,17-19H,10H2,1-5H3/t11-,12-,17+,18+,19+/m0/s1 |
| InChIKey | BLLDKYRAQDHVIZ-OHUKFJGISA-N |
| XLogP | 3.08 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |