C20H24N6 — CID 71105302
4-N-(2,3,4-trimethylphenyl)-2-N-(2,3,6-trimethyl-4-pyridinyl)-1,3,5-triazine-2,4-diamine (PubChem CID 71105302) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-N-(2,3,4-trimethylphenyl)-2-N-(2,3,6-trimethyl-4-pyridinyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(2,3,4-trimethylphenyl)-2-N-(2,3,6-trimethyl-4-pyridinyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 71105302 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 4-N-(2,3,4-trimethylphenyl)-2-N-(2,3,6-trimethyl-4-pyridinyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(Nc2ncnc(Nc3ccc(C)c(C)c3C)n2)c(C)c(C)n1 |
| InChI | InChI=1S/C20H24N6/c1-11-7-8-17(14(4)13(11)3)24-19-21-10-22-20(26-19)25-18-9-12(2)23-16(6)15(18)5/h7-10H,1-6H3,(H2,21,22,23,24,25,26) |
| InChIKey | AOEHYIGILUIXSE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |