C20H13F5N2O2 — CID 71105460
5-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)-N-[(2,3,6-trifluorophenyl)methyl]pyridin-2-amine (PubChem CID 71105460) has the molecular formula C20H13F5N2O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is 5-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)-N-[(2,3,6-trifluorophenyl)methyl]pyridin-2-amine.
| Compound Name | 5-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)-N-[(2,3,6-trifluorophenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 71105460 |
| Molecular Formula | C20H13F5N2O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 5-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)-N-[(2,3,6-trifluorophenyl)methyl]pyridin-2-amine |
| SMILES | Cc1cc2c(cc1-c1ccc(NCc3c(F)ccc(F)c3F)nc1)OC(F)(F)O2 |
| InChI | InChI=1S/C20H13F5N2O2/c1-10-6-16-17(29-20(24,25)28-16)7-12(10)11-2-5-18(26-8-11)27-9-13-14(21)3-4-15(22)19(13)23/h2-8H,9H2,1H3,(H,26,27) |
| InChIKey | PDFKQGIVAGQNLV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|