C14H18O9 — CID 71106833
(2,3,5-triacetyloxy-3,6-dihydro-2H-pyran-6-yl)methyl acetate (PubChem CID 71106833) has the molecular formula C14H18O9 and a molecular weight of 330.29 g/mol. Its IUPAC name is (2,3,5-triacetyloxy-3,6-dihydro-2H-pyran-6-yl)methyl acetate.
| Compound Name | (2,3,5-triacetyloxy-3,6-dihydro-2H-pyran-6-yl)methyl acetate |
|---|---|
| PubChem CID | 71106833 |
| Molecular Formula | C14H18O9 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (2,3,5-triacetyloxy-3,6-dihydro-2H-pyran-6-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C=C1OC(C)=O |
| InChI | InChI=1S/C14H18O9/c1-7(15)19-6-13-11(20-8(2)16)5-12(21-9(3)17)14(23-13)22-10(4)18/h5,12-14H,6H2,1-4H3 |
| InChIKey | HXJPZYYTUHMPHH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|