C12H20BN3O3 — CID 71108589
N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetamide (PubChem CID 71108589) has the molecular formula C12H20BN3O3 and a molecular weight of 265.12 g/mol. Its IUPAC name is N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetamide.
| Compound Name | N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 71108589 |
| Molecular Formula | C12H20BN3O3 |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetamide |
| SMILES | CNC(=O)Cn1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C12H20BN3O3/c1-11(2)12(3,4)19-13(18-11)9-6-15-16(7-9)8-10(17)14-5/h6-7H,8H2,1-5H3,(H,14,17) |
| InChIKey | CBACZCQOYFWCOQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|