About butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate
butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate (PubChem CID 71108628) has the molecular formula C18H32O3
and a molecular weight of 296.45 g/mol. Its IUPAC name is butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate |
| PubChem CID | 71108628 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate |
| SMILES | CCCCOC(=O)C1([C@@H](/C=C/C(C)C)OCCCC)CC1 |
| InChI | InChI=1S/C18H32O3/c1-5-7-13-20-16(10-9-15(3)4)18(11-12-18)17(19)21-14-8-6-2/h9-10,15-16H,5-8,11-14H2,1-4H3/b10-9+/t16-/m1/s1 |
| InChIKey | JPUOKXBAOZBUKR-ZNFPLGDCSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate?
The IUPAC name of butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate (CID 71108628) is butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate.
What is the SMILES notation for butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate?
The canonical SMILES for butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate is CCCCOC(=O)C1([C@@H](/C=C/C(C)C)OCCCC)CC1.
What is the InChIKey of butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate?
The InChIKey is JPUOKXBAOZBUKR-ZNFPLGDCSA-N. The full InChI is InChI=1S/C18H32O3/c1-5-7-13-20-16(10-9-15(3)4)18(11-12-18)17(19)21-14-8-6-2/h9-10,15-16H,5-8,11-14H2,1-4H3/b10-9+/t16-/m1/s1.
What are the key properties of butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate?
butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate has a molecular weight of 296.45 g/mol, XLogP of 4.51, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 1-[(E,1R)-1-butoxy-4-methylpent-2-enyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 71108628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).