About (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one
(9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one (PubChem CID 71108723) has the molecular formula C16H30N2O
and a molecular weight of 266.43 g/mol. Its IUPAC name is (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one.
Molecular Properties
| Compound Name | (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one |
| PubChem CID | 71108723 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one |
| SMILES | CCCC1CCCC/C=C\CCCC(=O)NCCN1 |
| InChI | InChI=1S/C16H30N2O/c1-2-10-15-11-8-6-4-3-5-7-9-12-16(19)18-14-13-17-15/h3,5,15,17H,2,4,6-14H2,1H3,(H,18,19)/b5-3- |
| InChIKey | HYFMISYJRWZPGF-HYXAFXHYSA-N |
| XLogP | 3.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one?
The IUPAC name of (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one (CID 71108723) is (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one.
What is the SMILES notation for (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one?
The canonical SMILES for (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one is CCCC1CCCC/C=C\CCCC(=O)NCCN1.
What is the InChIKey of (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one?
The InChIKey is HYFMISYJRWZPGF-HYXAFXHYSA-N. The full InChI is InChI=1S/C16H30N2O/c1-2-10-15-11-8-6-4-3-5-7-9-12-16(19)18-14-13-17-15/h3,5,15,17H,2,4,6-14H2,1H3,(H,18,19)/b5-3-.
What are the key properties of (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one?
(9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one has a molecular weight of 266.43 g/mol, XLogP of 3.16, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z)-15-propyl-1,4-diazacyclopentadec-9-en-5-one is sourced from PubChem (CID 71108723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).