C25H38N2O4S — CID 71108888
(1R,2S,6S,8Z,13R,14R,15S)-2,14-dihydroxy-1,15-dimethyl-6-[(E)-1-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione (PubChem CID 71108888) has the molecular formula C25H38N2O4S and a molecular weight of 462.66 g/mol. Its IUPAC name is (1R,2S,6S,8Z,13R,14R,15S)-2,14-dihydroxy-1,15-dimethyl-6-[(E)-1-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione.
| Compound Name | (1R,2S,6S,8Z,13R,14R,15S)-2,14-dihydroxy-1,15-dimethyl-6-[(E)-1-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione |
|---|---|
| PubChem CID | 71108888 |
| Molecular Formula | C25H38N2O4S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (1R,2S,6S,8Z,13R,14R,15S)-2,14-dihydroxy-1,15-dimethyl-6-[(E)-1-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione |
| SMILES | CC1=NC(/C=C(\C)[C@@H]2C/C=C\CCC[C@@H]3C[C@@](C)(C(=O)[C@@H](C)[C@@H]3O)[C@@H](O)CC(=O)N2)CS1 |
| InChI | InChI=1S/C25H38N2O4S/c1-15(11-19-14-32-17(3)26-19)20-10-8-6-5-7-9-18-13-25(4,21(28)12-22(29)27-20)24(31)16(2)23(18)30/h6,8,11,16,18-21,23,28,30H,5,7,9-10,12-14H2,1-4H3,(H,27,29)/b8-6-,15-11+/t16-,18+,19?,20-,21-,23-,25+/m0/s1 |
| InChIKey | WEAUOIABLOAPAQ-JEHMXRMRSA-N |
| XLogP | 3.42 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|