C26H40N2O4S — CID 71108893
(1R,2S,6S,8Z,13R,14S,15R)-2,14-dihydroxy-1,9,15-trimethyl-6-[(E)-1-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione (PubChem CID 71108893) has the molecular formula C26H40N2O4S and a molecular weight of 476.68 g/mol. Its IUPAC name is (1R,2S,6S,8Z,13R,14S,15R)-2,14-dihydroxy-1,9,15-trimethyl-6-[(E)-1-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione.
| Compound Name | (1R,2S,6S,8Z,13R,14S,15R)-2,14-dihydroxy-1,9,15-trimethyl-6-[(E)-1-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione |
|---|---|
| PubChem CID | 71108893 |
| Molecular Formula | C26H40N2O4S |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | (1R,2S,6S,8Z,13R,14S,15R)-2,14-dihydroxy-1,9,15-trimethyl-6-[(E)-1-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione |
| SMILES | CC1=NC(/C=C(\C)[C@@H]2C/C=C(/C)CCC[C@@H]3C[C@@](C)(C(=O)[C@H](C)[C@H]3O)[C@@H](O)CC(=O)N2)CS1 |
| InChI | InChI=1S/C26H40N2O4S/c1-15-7-6-8-19-13-26(5,25(32)17(3)24(19)31)22(29)12-23(30)28-21(10-9-15)16(2)11-20-14-33-18(4)27-20/h9,11,17,19-22,24,29,31H,6-8,10,12-14H2,1-5H3,(H,28,30)/b15-9-,16-11+/t17-,19-,20?,21+,22+,24-,26-/m1/s1 |
| InChIKey | CDCJQLFPUNBPCP-MOFMQGQNSA-N |
| XLogP | 3.81 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|