C35H34N4O3 — CID 71109443
2-[4-[[2,3-dimethyl-5-[[(1S)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 71109443) has the molecular formula C35H34N4O3 and a molecular weight of 558.68 g/mol. Its IUPAC name is 2-[4-[[2,3-dimethyl-5-[[(1S)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2,3-dimethyl-5-[[(1S)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71109443 |
| Molecular Formula | C35H34N4O3 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 2-[4-[[2,3-dimethyl-5-[[(1S)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)N[C@@H](C)c3cnc4c(c3)CCCN4)cc12 |
| InChI | InChI=1S/C35H34N4O3/c1-21-23(3)39(20-24-10-12-25(13-11-24)29-8-4-5-9-30(29)35(41)42)32-15-14-27(18-31(21)32)34(40)38-22(2)28-17-26-7-6-16-36-33(26)37-19-28/h4-5,8-15,17-19,22H,6-7,16,20H2,1-3H3,(H,36,37)(H,38,40)(H,41,42)/t22-/m0/s1 |
| InChIKey | PTXJLRSAEDEEMD-QFIPXVFZSA-N |
| XLogP | 6.92 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|