C19H22N2O7 — CID 71109506
[4-[4-[hydroxy-[1,2,3-trihydroxy-4-(hydroxymethyl)cyclobutyl]methoxy]phenyl]phenyl]urea (PubChem CID 71109506) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is [4-[4-[hydroxy-[1,2,3-trihydroxy-4-(hydroxymethyl)cyclobutyl]methoxy]phenyl]phenyl]urea.
| Compound Name | [4-[4-[hydroxy-[1,2,3-trihydroxy-4-(hydroxymethyl)cyclobutyl]methoxy]phenyl]phenyl]urea |
|---|---|
| PubChem CID | 71109506 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [4-[4-[hydroxy-[1,2,3-trihydroxy-4-(hydroxymethyl)cyclobutyl]methoxy]phenyl]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(-c2ccc(OC(O)C3(O)C(O)C(O)C3CO)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O7/c20-18(26)21-12-5-1-10(2-6-12)11-3-7-13(8-4-11)28-17(25)19(27)14(9-22)15(23)16(19)24/h1-8,14-17,22-25,27H,9H2,(H3,20,21,26) |
| InChIKey | DLGBVYLEPMOCDM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 165.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|