C30H29F3N2O4 — CID 71109847
(2S)-2-[3-[[2,3-dimethyl-5-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]indol-1-yl]methyl]phenoxy]propanoic acid (PubChem CID 71109847) has the molecular formula C30H29F3N2O4 and a molecular weight of 538.57 g/mol. Its IUPAC name is (2S)-2-[3-[[2,3-dimethyl-5-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]indol-1-yl]methyl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[3-[[2,3-dimethyl-5-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]indol-1-yl]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 71109847 |
| Molecular Formula | C30H29F3N2O4 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | (2S)-2-[3-[[2,3-dimethyl-5-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]carbamoyl]indol-1-yl]methyl]phenoxy]propanoic acid |
| SMILES | Cc1c(C)n(Cc2cccc(O[C@@H](C)C(=O)O)c2)c2ccc(C(=O)N[C@@H](C)c3ccc(C(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C30H29F3N2O4/c1-17-19(3)35(16-21-6-5-7-25(14-21)39-20(4)29(37)38)27-13-10-23(15-26(17)27)28(36)34-18(2)22-8-11-24(12-9-22)30(31,32)33/h5-15,18,20H,16H2,1-4H3,(H,34,36)(H,37,38)/t18-,20-/m0/s1 |
| InChIKey | UJDJWVXKMUZQKW-ICSRJNTNSA-N |
| XLogP | 6.67 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|