C21H23N — CID 71110121
(4aR)-7,7-dimethyl-5,6,6a,8,9,12b-hexahydro-4aH-indeno[2,1-b]carbazole (PubChem CID 71110121) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is (4aR)-7,7-dimethyl-5,6,6a,8,9,12b-hexahydro-4aH-indeno[2,1-b]carbazole.
| Compound Name | (4aR)-7,7-dimethyl-5,6,6a,8,9,12b-hexahydro-4aH-indeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 71110121 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (4aR)-7,7-dimethyl-5,6,6a,8,9,12b-hexahydro-4aH-indeno[2,1-b]carbazole |
| SMILES | CC1(C)C2=C(C=CCC2)C2=CC3=C(CC21)N[C@@H]1C=CC=CC31 |
| InChI | InChI=1S/C21H23N/c1-21(2)17-9-5-3-7-13(17)15-11-16-14-8-4-6-10-19(14)22-20(16)12-18(15)21/h3-4,6-8,10-11,14,18-19,22H,5,9,12H2,1-2H3/t14?,18?,19-/m1/s1 |
| InChIKey | SDXCPLNZYKWDJY-DNOPENIRSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |