C21H26F2O — CID 71110246
2-[difluoro-(3,3,5-trimethylcyclohepta-1,4,6-trien-1-yl)methoxy]-5,7,7-trimethylcyclohepta-1,3,5-triene (PubChem CID 71110246) has the molecular formula C21H26F2O and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-[difluoro-(3,3,5-trimethylcyclohepta-1,4,6-trien-1-yl)methoxy]-5,7,7-trimethylcyclohepta-1,3,5-triene.
| Compound Name | 2-[difluoro-(3,3,5-trimethylcyclohepta-1,4,6-trien-1-yl)methoxy]-5,7,7-trimethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 71110246 |
| Molecular Formula | C21H26F2O |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[difluoro-(3,3,5-trimethylcyclohepta-1,4,6-trien-1-yl)methoxy]-5,7,7-trimethylcyclohepta-1,3,5-triene |
| SMILES | CC1=CC(C)(C)C=C(OC(F)(F)C2=CC(C)(C)C=C(C)C=C2)C=C1 |
| InChI | InChI=1S/C21H26F2O/c1-15-7-9-17(13-19(3,4)11-15)21(22,23)24-18-10-8-16(2)12-20(5,6)14-18/h7-14H,1-6H3 |
| InChIKey | ZCWWMERGVWCXTB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |