C33H27N7 — CID 71110389
16-methyl-2,8,14-triphenyl-2,4,6,8,10,12,14-heptazatetracyclo[13.3.1.13,7.19,13]henicosa-1(19),3,5,7(21),9(20),10,12,17-octaene (PubChem CID 71110389) has the molecular formula C33H27N7 and a molecular weight of 521.63 g/mol. Its IUPAC name is 16-methyl-2,8,14-triphenyl-2,4,6,8,10,12,14-heptazatetracyclo[13.3.1.13,7.19,13]henicosa-1(19),3,5,7(21),9(20),10,12,17-octaene.
| Compound Name | 16-methyl-2,8,14-triphenyl-2,4,6,8,10,12,14-heptazatetracyclo[13.3.1.13,7.19,13]henicosa-1(19),3,5,7(21),9(20),10,12,17-octaene |
|---|---|
| PubChem CID | 71110389 |
| Molecular Formula | C33H27N7 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 16-methyl-2,8,14-triphenyl-2,4,6,8,10,12,14-heptazatetracyclo[13.3.1.13,7.19,13]henicosa-1(19),3,5,7(21),9(20),10,12,17-octaene |
| SMILES | CC1C=CC2=CC1N(c1ccccc1)c1cc(ncn1)N(c1ccccc1)c1cc(ncn1)N2c1ccccc1 |
| InChI | InChI=1S/C33H27N7/c1-24-17-18-28-19-29(24)39(26-13-7-3-8-14-26)31-21-33(37-23-35-31)40(27-15-9-4-10-16-27)32-20-30(34-22-36-32)38(28)25-11-5-2-6-12-25/h2-24,29H,1H3 |
| InChIKey | TUTPHWCRXWOTIU-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 61.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |