C35H44N4O5 — CID 71110479
ethyl 3,13-diethyl-10-methoxy-7,7,17,17-tetramethyl-12-(4-methyl-1,3-dioxetan-2-yl)-8,18,21,23-tetrahydroporphyrin-2-carboxylate (PubChem CID 71110479) has the molecular formula C35H44N4O5 and a molecular weight of 600.76 g/mol. Its IUPAC name is ethyl 3,13-diethyl-10-methoxy-7,7,17,17-tetramethyl-12-(4-methyl-1,3-dioxetan-2-yl)-8,18,21,23-tetrahydroporphyrin-2-carboxylate.
| Compound Name | ethyl 3,13-diethyl-10-methoxy-7,7,17,17-tetramethyl-12-(4-methyl-1,3-dioxetan-2-yl)-8,18,21,23-tetrahydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 71110479 |
| Molecular Formula | C35H44N4O5 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | ethyl 3,13-diethyl-10-methoxy-7,7,17,17-tetramethyl-12-(4-methyl-1,3-dioxetan-2-yl)-8,18,21,23-tetrahydroporphyrin-2-carboxylate |
| SMILES | CCOC(=O)c1c(CC)c2cc3nc(c(OC)c4[nH]c(cc5nc(cc1[nH]2)CC5(C)C)c(CC)c4C1OC(C)O1)CC3(C)C |
| InChI | InChI=1S/C35H44N4O5/c1-10-20-22-14-27-35(7,8)17-25(38-27)31(41-9)30-29(33-43-18(4)44-33)21(11-2)23(39-30)15-26-34(5,6)16-19(36-26)13-24(37-22)28(20)32(40)42-12-3/h13-15,18,33,37,39H,10-12,16-17H2,1-9H3/b19-13-,22-14-,23-15-,24-13-,26-15-,27-14-,31-25+,31-30+ |
| InChIKey | YKRJOQYOHJXBSY-AHXBUBAISA-N |
| XLogP | 7.06 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |