About 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene
1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene (PubChem CID 71110721) has the molecular formula C13H16S
and a molecular weight of 204.34 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene |
| PubChem CID | 71110721 |
| Molecular Formula | C13H16S |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene |
| SMILES | CC1=CC=C(SC2=CC=CCC2)CC1 |
| InChI | InChI=1S/C13H16S/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12/h2-3,5,7,9H,4,6,8,10H2,1H3 |
| InChIKey | TUPQLHHVTFAMCU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene?
The IUPAC name of 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene (CID 71110721) is 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene is CC1=CC=C(SC2=CC=CCC2)CC1.
What is the InChIKey of 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene?
The InChIKey is TUPQLHHVTFAMCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16S/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12/h2-3,5,7,9H,4,6,8,10H2,1H3.
What are the key properties of 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene?
1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene has a molecular weight of 204.34 g/mol, XLogP of 4.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-ylsulfanyl-4-methylcyclohexa-1,3-diene is sourced from PubChem (CID 71110721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).