C28H31FO6 — CID 71110795
(2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-5-(4-fluorophenyl)-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71110795) has the molecular formula C28H31FO6 and a molecular weight of 482.55 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-5-(4-fluorophenyl)-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-5-(4-fluorophenyl)-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71110795 |
| Molecular Formula | C28H31FO6 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-5-(4-fluorophenyl)-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(-c3ccc(F)cc3)c2C)cc1 |
| InChI | InChI=1S/C28H31FO6/c1-3-34-22-10-4-17(5-11-22)12-19-13-20(28-27(33)26(32)25(31)24(15-30)35-28)14-23(16(19)2)18-6-8-21(29)9-7-18/h4-11,13-14,24-28,30-33H,3,12,15H2,1-2H3/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | WDYNNNGIXYTMNA-DFLSAPQXSA-N |
| XLogP | 3.31 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |