C23H28ClNO5 — CID 71110834
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-pyrrolidin-1-ylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71110834) has the molecular formula C23H28ClNO5 and a molecular weight of 433.93 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-pyrrolidin-1-ylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-pyrrolidin-1-ylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71110834 |
| Molecular Formula | C23H28ClNO5 |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-pyrrolidin-1-ylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(N4CCCC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H28ClNO5/c24-18-8-5-15(23-22(29)21(28)20(27)19(13-26)30-23)12-16(18)11-14-3-6-17(7-4-14)25-9-1-2-10-25/h3-8,12,19-23,26-29H,1-2,9-11,13H2/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | BELNASQJDLDPMJ-ZQGJOIPISA-N |
| XLogP | 2.05 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|