C30H44N10O3 — CID 71111889
4-N,6-N,7-N-tris(2-morpholin-4-ylethyl)-2-phenylpteridine-4,6,7-triamine (PubChem CID 71111889) has the molecular formula C30H44N10O3 and a molecular weight of 592.75 g/mol. Its IUPAC name is 4-N,6-N,7-N-tris(2-morpholin-4-ylethyl)-2-phenylpteridine-4,6,7-triamine.
| Compound Name | 4-N,6-N,7-N-tris(2-morpholin-4-ylethyl)-2-phenylpteridine-4,6,7-triamine |
|---|---|
| PubChem CID | 71111889 |
| Molecular Formula | C30H44N10O3 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | 4-N,6-N,7-N-tris(2-morpholin-4-ylethyl)-2-phenylpteridine-4,6,7-triamine |
| SMILES | c1ccc(-c2nc(NCCN3CCOCC3)c3nc(NCCN4CCOCC4)c(NCCN4CCOCC4)nc3n2)cc1 |
| InChI | InChI=1S/C30H44N10O3/c1-2-4-24(5-3-1)26-35-27(31-6-9-38-12-18-41-19-13-38)25-28(36-26)37-30(33-8-11-40-16-22-43-23-17-40)29(34-25)32-7-10-39-14-20-42-21-15-39/h1-5H,6-23H2,(H,32,34)(H2,31,33,35,36,37) |
| InChIKey | FOPJIYREMUXSGN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |