C22H26N10 — CID 71111947
7-(4-methylpiperazin-1-yl)-2-phenyl-N-[3-(1,2,4-triazol-1-yl)propyl]pteridin-4-amine (PubChem CID 71111947) has the molecular formula C22H26N10 and a molecular weight of 430.52 g/mol. Its IUPAC name is 7-(4-methylpiperazin-1-yl)-2-phenyl-N-[3-(1,2,4-triazol-1-yl)propyl]pteridin-4-amine.
| Compound Name | 7-(4-methylpiperazin-1-yl)-2-phenyl-N-[3-(1,2,4-triazol-1-yl)propyl]pteridin-4-amine |
|---|---|
| PubChem CID | 71111947 |
| Molecular Formula | C22H26N10 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 7-(4-methylpiperazin-1-yl)-2-phenyl-N-[3-(1,2,4-triazol-1-yl)propyl]pteridin-4-amine |
| SMILES | CN1CCN(c2cnc3c(NCCCn4cncn4)nc(-c4ccccc4)nc3n2)CC1 |
| InChI | InChI=1S/C22H26N10/c1-30-10-12-31(13-11-30)18-14-25-19-21(24-8-5-9-32-16-23-15-26-32)28-20(29-22(19)27-18)17-6-3-2-4-7-17/h2-4,6-7,14-16H,5,8-13H2,1H3,(H,24,27,28,29) |
| InChIKey | RNHZXCWUEBJJPH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|