C24H24ClFN2O — CID 71111986
(2R)-2-[[3-(4-chlorophenyl)-1-(4-fluoro-3-methylphenyl)propyl]amino]-2-phenylacetamide (PubChem CID 71111986) has the molecular formula C24H24ClFN2O and a molecular weight of 410.92 g/mol. Its IUPAC name is (2R)-2-[[3-(4-chlorophenyl)-1-(4-fluoro-3-methylphenyl)propyl]amino]-2-phenylacetamide.
| Compound Name | (2R)-2-[[3-(4-chlorophenyl)-1-(4-fluoro-3-methylphenyl)propyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 71111986 |
| Molecular Formula | C24H24ClFN2O |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (2R)-2-[[3-(4-chlorophenyl)-1-(4-fluoro-3-methylphenyl)propyl]amino]-2-phenylacetamide |
| SMILES | Cc1cc(C(CCc2ccc(Cl)cc2)N[C@@H](C(N)=O)c2ccccc2)ccc1F |
| InChI | InChI=1S/C24H24ClFN2O/c1-16-15-19(10-13-21(16)26)22(14-9-17-7-11-20(25)12-8-17)28-23(24(27)29)18-5-3-2-4-6-18/h2-8,10-13,15,22-23,28H,9,14H2,1H3,(H2,27,29)/t22?,23-/m1/s1 |
| InChIKey | BACQGNVABVZDGI-OZAIVSQSSA-N |
| XLogP | 5.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |