C18H18N4O — CID 71112238
12-methyl-6-pyridin-2-yl-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one (PubChem CID 71112238) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 12-methyl-6-pyridin-2-yl-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one.
| Compound Name | 12-methyl-6-pyridin-2-yl-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one |
|---|---|
| PubChem CID | 71112238 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 12-methyl-6-pyridin-2-yl-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one |
| SMILES | CC1CCCn2c(nc3cc(-c4ccccn4)cnc3c2=O)C1 |
| InChI | InChI=1S/C18H18N4O/c1-12-5-4-8-22-16(9-12)21-15-10-13(11-20-17(15)18(22)23)14-6-2-3-7-19-14/h2-3,6-7,10-12H,4-5,8-9H2,1H3 |
| InChIKey | AQQIYDBAGWHKBS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |