C29H24F3N7O2 — CID 71112973
N-[5-[9-oxo-10-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrido[3,2-h][1,5]naphthyridin-2-yl]-2-pyridinyl]acetamide (PubChem CID 71112973) has the molecular formula C29H24F3N7O2 and a molecular weight of 559.55 g/mol. Its IUPAC name is N-[5-[9-oxo-10-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrido[3,2-h][1,5]naphthyridin-2-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[5-[9-oxo-10-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrido[3,2-h][1,5]naphthyridin-2-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 71112973 |
| Molecular Formula | C29H24F3N7O2 |
| Molecular Weight | 559.55 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | N-[5-[9-oxo-10-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]pyrido[3,2-h][1,5]naphthyridin-2-yl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ccc3ncc4ccc(=O)n(-c5ccc(N6CCNCC6)c(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C29H24F3N7O2/c1-17(40)36-25-8-2-18(15-35-25)22-5-6-23-27(37-22)28-19(16-34-23)3-9-26(41)39(28)20-4-7-24(21(14-20)29(30,31)32)38-12-10-33-11-13-38/h2-9,14-16,33H,10-13H2,1H3,(H,35,36,40) |
| InChIKey | FUCQOMMTFDEWJE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|