About tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate
tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate (PubChem CID 71113127) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate |
| PubChem CID | 71113127 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate |
| SMILES | Cc1nc(C(C)(C)NC(=O)OC(C)(C)C)no1 |
| InChI | InChI=1S/C11H19N3O3/c1-7-12-8(14-17-7)11(5,6)13-9(15)16-10(2,3)4/h1-6H3,(H,13,15) |
| InChIKey | ZXCROKPMFFPYCP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate (CID 71113127) is tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate is Cc1nc(C(C)(C)NC(=O)OC(C)(C)C)no1.
What is the InChIKey of tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate?
The InChIKey is ZXCROKPMFFPYCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3/c1-7-12-8(14-17-7)11(5,6)13-9(15)16-10(2,3)4/h1-6H3,(H,13,15).
What are the key properties of tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate?
tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate has a molecular weight of 241.29 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]carbamate is sourced from PubChem (CID 71113127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).