About 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate
3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate (PubChem CID 71113258) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate |
| PubChem CID | 71113258 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate |
| SMILES | O=C(OCCCC1OCCO1)C1CCCCC1 |
| InChI | InChI=1S/C13H22O4/c14-13(11-5-2-1-3-6-11)17-8-4-7-12-15-9-10-16-12/h11-12H,1-10H2 |
| InChIKey | RJINWYUNSZSRRT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate?
The IUPAC name of 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate (CID 71113258) is 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate.
What is the SMILES notation for 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate?
The canonical SMILES for 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate is O=C(OCCCC1OCCO1)C1CCCCC1.
What is the InChIKey of 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate?
The InChIKey is RJINWYUNSZSRRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c14-13(11-5-2-1-3-6-11)17-8-4-7-12-15-9-10-16-12/h11-12H,1-10H2.
What are the key properties of 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate?
3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate has a molecular weight of 242.31 g/mol, XLogP of 2.26, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxolan-2-yl)propyl cyclohexanecarboxylate is sourced from PubChem (CID 71113258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).