C36H17N5O3S2 — CID 71113508
17-naphthalen-2-yl-6,7-dithiophen-2-yl-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 71113508) has the molecular formula C36H17N5O3S2 and a molecular weight of 631.70 g/mol. Its IUPAC name is 17-naphthalen-2-yl-6,7-dithiophen-2-yl-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 17-naphthalen-2-yl-6,7-dithiophen-2-yl-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 71113508 |
| Molecular Formula | C36H17N5O3S2 |
| Molecular Weight | 631.70 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | 17-naphthalen-2-yl-6,7-dithiophen-2-yl-3,5,8,10,17-pentazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | O=C1c2ccc3c(=O)n4c5nc(-c6cccs6)c(-c6cccs6)nc5nc4c4ccc(c2c34)C(=O)N1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C36H17N5O3S2/c42-34-23-12-11-21-27-22(13-14-24(28(23)27)35(43)40(34)20-10-9-18-5-1-2-6-19(18)17-20)36(44)41-32(21)39-31-33(41)38-30(26-8-4-16-46-26)29(37-31)25-7-3-15-45-25/h1-17H |
| InChIKey | FBBPGBJHPLCWGP-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 97.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.70 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|