C35H18N6O3 — CID 71113512
6,7,17-tripyridin-2-yl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 71113512) has the molecular formula C35H18N6O3 and a molecular weight of 570.57 g/mol. Its IUPAC name is 6,7,17-tripyridin-2-yl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 6,7,17-tripyridin-2-yl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 71113512 |
| Molecular Formula | C35H18N6O3 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | 6,7,17-tripyridin-2-yl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | O=C1c2ccc3c(=O)n4c5cc(-c6ccccn6)c(-c6ccccn6)cc5nc4c4ccc(c2c34)C(=O)N1c1ccccn1 |
| InChI | InChI=1S/C35H18N6O3/c42-33-20-12-13-22-31-21(34(43)41(35(22)44)29-9-3-6-16-38-29)11-10-19(30(20)31)32-39-27-17-23(25-7-1-4-14-36-25)24(18-28(27)40(32)33)26-8-2-5-15-37-26/h1-18H |
| InChIKey | WLNUAXBJMDMFQX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 110.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|