About 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine
7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine (PubChem CID 71113807) has the molecular formula C20H23N5O
and a molecular weight of 349.44 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine.
Molecular Properties
| Compound Name | 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine |
| PubChem CID | 71113807 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine |
| SMILES | COc1ccc(-c2cc3nccnc3c(NCC3CCCNC3)n2)cc1 |
| InChI | InChI=1S/C20H23N5O/c1-26-16-6-4-15(5-7-16)17-11-18-19(23-10-9-22-18)20(25-17)24-13-14-3-2-8-21-12-14/h4-7,9-11,14,21H,2-3,8,12-13H2,1H3,(H,24,25) |
| InChIKey | OMEUMAYPCCSBGL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine?
The IUPAC name of 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine (CID 71113807) is 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine.
What is the SMILES notation for 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine?
The canonical SMILES for 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine is COc1ccc(-c2cc3nccnc3c(NCC3CCCNC3)n2)cc1.
What is the InChIKey of 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine?
The InChIKey is OMEUMAYPCCSBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O/c1-26-16-6-4-15(5-7-16)17-11-18-19(23-10-9-22-18)20(25-17)24-13-14-3-2-8-21-12-14/h4-7,9-11,14,21H,2-3,8,12-13H2,1H3,(H,24,25).
What are the key properties of 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine?
7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine has a molecular weight of 349.44 g/mol, XLogP of 3.11, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-methoxyphenyl)-N-(piperidin-3-ylmethyl)pyrido[3,4-b]pyrazin-5-amine is sourced from PubChem (CID 71113807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).